C18H28N2OS — CID 45238572
5-[2-[(3-methylphenyl)methylamino]ethyl]-1-(3-methylsulfanylpropyl)pyrrolidin-2-one (PubChem CID 45238572) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is 5-[2-[(3-methylphenyl)methylamino]ethyl]-1-(3-methylsulfanylpropyl)pyrrolidin-2-one.
| Compound Name | 5-[2-[(3-methylphenyl)methylamino]ethyl]-1-(3-methylsulfanylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 45238572 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 5-[2-[(3-methylphenyl)methylamino]ethyl]-1-(3-methylsulfanylpropyl)pyrrolidin-2-one |
| SMILES | CSCCCN1C(=O)CCC1CCNCc1cccc(C)c1 |
| InChI | InChI=1S/C18H28N2OS/c1-15-5-3-6-16(13-15)14-19-10-9-17-7-8-18(21)20(17)11-4-12-22-2/h3,5-6,13,17,19H,4,7-12,14H2,1-2H3 |
| InChIKey | APUGSGOPWGXLEI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|