C21H24F2N2O — CID 45180876
1-[(2,6-difluorophenyl)methyl]-5-[2-[(3-methylphenyl)methylamino]ethyl]pyrrolidin-2-one (PubChem CID 45180876) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-5-[2-[(3-methylphenyl)methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-5-[2-[(3-methylphenyl)methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 45180876 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-5-[2-[(3-methylphenyl)methylamino]ethyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(CNCCC2CCC(=O)N2Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C21H24F2N2O/c1-15-4-2-5-16(12-15)13-24-11-10-17-8-9-21(26)25(17)14-18-19(22)6-3-7-20(18)23/h2-7,12,17,24H,8-11,13-14H2,1H3 |
| InChIKey | HOJVJOXRWCYYBY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|