C18H27FN2O — CID 129490823
(5R)-5-[2-[(3-fluorophenyl)methylamino]ethyl]-1-(3-methylbutyl)pyrrolidin-2-one (PubChem CID 129490823) has the molecular formula C18H27FN2O and a molecular weight of 306.42 g/mol. Its IUPAC name is (5R)-5-[2-[(3-fluorophenyl)methylamino]ethyl]-1-(3-methylbutyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[(3-fluorophenyl)methylamino]ethyl]-1-(3-methylbutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129490823 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (5R)-5-[2-[(3-fluorophenyl)methylamino]ethyl]-1-(3-methylbutyl)pyrrolidin-2-one |
| SMILES | CC(C)CCN1C(=O)CC[C@@H]1CCNCc1cccc(F)c1 |
| InChI | InChI=1S/C18H27FN2O/c1-14(2)9-11-21-17(6-7-18(21)22)8-10-20-13-15-4-3-5-16(19)12-15/h3-5,12,14,17,20H,6-11,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | GVUKPBGRDCQHPY-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|