C23H30N2O2 — CID 26276309
(5R)-5-[2-[(3-methoxyphenyl)methylamino]ethyl]-1-[(2S)-2-phenylpropyl]pyrrolidin-2-one (PubChem CID 26276309) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (5R)-5-[2-[(3-methoxyphenyl)methylamino]ethyl]-1-[(2S)-2-phenylpropyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[(3-methoxyphenyl)methylamino]ethyl]-1-[(2S)-2-phenylpropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26276309 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (5R)-5-[2-[(3-methoxyphenyl)methylamino]ethyl]-1-[(2S)-2-phenylpropyl]pyrrolidin-2-one |
| SMILES | COc1cccc(CNCC[C@H]2CCC(=O)N2C[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-18(20-8-4-3-5-9-20)17-25-21(11-12-23(25)26)13-14-24-16-19-7-6-10-22(15-19)27-2/h3-10,15,18,21,24H,11-14,16-17H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | NQKXXJGVFTULJY-WIYYLYMNSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|