C13H18N2 — CID 115757833
N-[(1-cyclopropylcyclopropyl)methyl]-1-pyridin-3-ylmethanamine (PubChem CID 115757833) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[(1-cyclopropylcyclopropyl)methyl]-1-pyridin-3-ylmethanamine.
| Compound Name | N-[(1-cyclopropylcyclopropyl)methyl]-1-pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 115757833 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[(1-cyclopropylcyclopropyl)methyl]-1-pyridin-3-ylmethanamine |
| SMILES | c1cncc(CNCC2(C3CC3)CC2)c1 |
| InChI | InChI=1S/C13H18N2/c1-2-11(8-14-7-1)9-15-10-13(5-6-13)12-3-4-12/h1-2,7-8,12,15H,3-6,9-10H2 |
| InChIKey | CXMNOPSELWLCRS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |