C16H18N2 — CID 79978828
1-(4-cyclopropylphenyl)-N-(pyridin-3-ylmethyl)methanamine (PubChem CID 79978828) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)-N-(pyridin-3-ylmethyl)methanamine.
| Compound Name | 1-(4-cyclopropylphenyl)-N-(pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 79978828 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(4-cyclopropylphenyl)-N-(pyridin-3-ylmethyl)methanamine |
| SMILES | c1cncc(CNCc2ccc(C3CC3)cc2)c1 |
| InChI | InChI=1S/C16H18N2/c1-2-14(11-17-9-1)12-18-10-13-3-5-15(6-4-13)16-7-8-16/h1-6,9,11,16,18H,7-8,10,12H2 |
| InChIKey | ZOEWACPCMSGJFK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |