C23H26N4O — CID 45176010
5-[2-(benzylamino)ethyl]-1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidin-2-one (PubChem CID 45176010) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[2-(benzylamino)ethyl]-1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 5-[2-(benzylamino)ethyl]-1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 45176010 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 5-[2-(benzylamino)ethyl]-1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CCNCc2ccccc2)N1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C23H26N4O/c28-23-12-11-21(13-15-24-17-19-5-2-1-3-6-19)26(23)18-20-7-9-22(10-8-20)27-16-4-14-25-27/h1-10,14,16,21,24H,11-13,15,17-18H2 |
| InChIKey | RFCWLTIHCMSZQC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|