C20H28F3NO2 — CID 71260737
tert-butyl 4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperidine-1-carboxylate (PubChem CID 71260737) has the molecular formula C20H28F3NO2 and a molecular weight of 371.44 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71260737 |
| Molecular Formula | C20H28F3NO2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl 4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperidine-1-carboxylate |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28F3NO2/c1-14(12-15-6-5-7-17(13-15)20(21,22)23)16-8-10-24(11-9-16)18(25)26-19(2,3)4/h5-7,13-14,16H,8-12H2,1-4H3 |
| InChIKey | ZHSVOEPXBRUVKZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |