C22H30F3NO3 — CID 110157009
tert-butyl (2S,4aS,8aR)-2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine-6-carboxylate (PubChem CID 110157009) has the molecular formula C22H30F3NO3 and a molecular weight of 413.48 g/mol. Its IUPAC name is tert-butyl (2S,4aS,8aR)-2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl (2S,4aS,8aR)-2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 110157009 |
| Molecular Formula | C22H30F3NO3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | tert-butyl (2S,4aS,8aR)-2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2O[C@](C)(Cc3cccc(C(F)(F)F)c3)CC[C@H]2C1 |
| InChI | InChI=1S/C22H30F3NO3/c1-20(2,3)29-19(27)26-11-9-18-16(14-26)8-10-21(4,28-18)13-15-6-5-7-17(12-15)22(23,24)25/h5-7,12,16,18H,8-11,13-14H2,1-4H3/t16-,18+,21-/m0/s1 |
| InChIKey | GRFDYOROLQNRNO-CDXJDZJCSA-N |
| XLogP | 5.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |