C27H32F2N2O4 — CID 11755156
7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoic acid (PubChem CID 11755156) has the molecular formula C27H32F2N2O4 and a molecular weight of 486.56 g/mol. Its IUPAC name is 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 11755156 |
| Molecular Formula | C27H32F2N2O4 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)N(Cc2ccccc2)C[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C27H32F2N2O4/c28-27(29,22-13-7-4-8-14-22)24(32)17-16-23-20-30(19-21-11-5-3-6-12-21)26(35)31(23)18-10-2-1-9-15-25(33)34/h3-8,11-14,16-17,23-24,32H,1-2,9-10,15,18-20H2,(H,33,34)/b17-16+/t23-,24?/m0/s1 |
| InChIKey | HTMWYDUJDIDBJQ-DYDCLWMBSA-N |
| XLogP | 5.04 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|