C20H23F4NO5 — CID 10432990
7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]-4,4-difluoroheptanoic acid (PubChem CID 10432990) has the molecular formula C20H23F4NO5 and a molecular weight of 433.40 g/mol. Its IUPAC name is 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]-4,4-difluoroheptanoic acid.
| Compound Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]-4,4-difluoroheptanoic acid |
|---|---|
| PubChem CID | 10432990 |
| Molecular Formula | C20H23F4NO5 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]-4,4-difluoroheptanoic acid |
| SMILES | O=C(O)CCC(F)(F)CCCN1C(=O)OCC1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C20H23F4NO5/c21-19(22,11-9-17(27)28)10-4-12-25-15(13-30-18(25)29)7-8-16(26)20(23,24)14-5-2-1-3-6-14/h1-3,5-8,15-16,26H,4,9-13H2,(H,27,28)/b8-7+ |
| InChIKey | NCKONMKWWOOFRL-BQYQJAHWSA-N |
| XLogP | 3.80 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|