C20H21F2N5O3 — CID 10251388
4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[6-(2H-tetrazol-5-yl)hex-4-ynyl]-1,3-oxazolidin-2-one (PubChem CID 10251388) has the molecular formula C20H21F2N5O3 and a molecular weight of 417.42 g/mol. Its IUPAC name is 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[6-(2H-tetrazol-5-yl)hex-4-ynyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[6-(2H-tetrazol-5-yl)hex-4-ynyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10251388 |
| Molecular Formula | C20H21F2N5O3 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[6-(2H-tetrazol-5-yl)hex-4-ynyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(/C=C/C(O)C(F)(F)c2ccccc2)N1CCCC#CCc1nn[nH]n1 |
| InChI | InChI=1S/C20H21F2N5O3/c21-20(22,15-8-4-3-5-9-15)17(28)12-11-16-14-30-19(29)27(16)13-7-2-1-6-10-18-23-25-26-24-18/h3-5,8-9,11-12,16-17,28H,2,7,10,13-14H2,(H,23,24,25,26)/b12-11+ |
| InChIKey | YAFYXUKUMPCGRY-VAWYXSNFSA-N |
| XLogP | 2.06 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|