C22H29F2N5O2 — CID 11464654
(6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]piperidin-2-one (PubChem CID 11464654) has the molecular formula C22H29F2N5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]piperidin-2-one.
| Compound Name | (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]piperidin-2-one |
|---|---|
| PubChem CID | 11464654 |
| Molecular Formula | C22H29F2N5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[6-(2H-tetrazol-5-yl)hexyl]piperidin-2-one |
| SMILES | O=C1CCC[C@H](/C=C/[C@@H](O)C(F)(F)c2ccccc2)N1CCCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C22H29F2N5O2/c23-22(24,17-9-4-3-5-10-17)19(30)15-14-18-11-8-13-21(31)29(18)16-7-2-1-6-12-20-25-27-28-26-20/h3-5,9-10,14-15,18-19,30H,1-2,6-8,11-13,16H2,(H,25,26,27,28)/b15-14+/t18-,19-/m1/s1 |
| InChIKey | CMPZCNXCJCXZJY-AWHXWDPHSA-N |
| XLogP | 3.39 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|