C23H23F2NO5 — CID 11743461
3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]benzoic acid (PubChem CID 11743461) has the molecular formula C23H23F2NO5 and a molecular weight of 431.44 g/mol. Its IUPAC name is 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]benzoic acid.
| Compound Name | 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]benzoic acid |
|---|---|
| PubChem CID | 11743461 |
| Molecular Formula | C23H23F2NO5 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCCN2C(=O)OCC2/C=C/C(O)C(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23F2NO5/c24-23(25,18-9-2-1-3-10-18)20(27)12-11-19-15-31-22(30)26(19)13-5-7-16-6-4-8-17(14-16)21(28)29/h1-4,6,8-12,14,19-20,27H,5,7,13,15H2,(H,28,29)/b12-11+ |
| InChIKey | REMFDBIPHSTGGP-VAWYXSNFSA-N |
| XLogP | 3.85 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|