C21H26BrF2NO5 — CID 68991970
7-[(4R)-4-[(3R)-4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid (PubChem CID 68991970) has the molecular formula C21H26BrF2NO5 and a molecular weight of 490.34 g/mol. Its IUPAC name is 7-[(4R)-4-[(3R)-4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid.
| Compound Name | 7-[(4R)-4-[(3R)-4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 68991970 |
| Molecular Formula | C21H26BrF2NO5 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 7-[(4R)-4-[(3R)-4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)OCC[C@@H]1C=C[C@@H](O)C(F)(F)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H26BrF2NO5/c22-16-7-5-6-15(14-16)21(23,24)18(26)10-9-17-11-13-30-20(29)25(17)12-4-2-1-3-8-19(27)28/h5-7,9-10,14,17-18,26H,1-4,8,11-13H2,(H,27,28)/t17-,18+/m0/s1 |
| InChIKey | WHAVJBLZUOIMBQ-ZWKOTPCHSA-N |
| XLogP | 4.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|