C27H32F2N2O4S — CID 10481733
2-[4-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid (PubChem CID 10481733) has the molecular formula C27H32F2N2O4S and a molecular weight of 518.63 g/mol. Its IUPAC name is 2-[4-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid.
| Compound Name | 2-[4-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10481733 |
| Molecular Formula | C27H32F2N2O4S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[4-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
| SMILES | CC(SCCCCN1C(=O)N(Cc2ccccc2)C[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H32F2N2O4S/c1-20(25(33)34)36-17-9-8-16-31-23(19-30(26(31)35)18-21-10-4-2-5-11-21)14-15-24(32)27(28,29)22-12-6-3-7-13-22/h2-7,10-15,20,23-24,32H,8-9,16-19H2,1H3,(H,33,34)/b15-14+/t20?,23-,24?/m0/s1 |
| InChIKey | OJHZTMRKBVBXGX-JSKUJGGOSA-N |
| XLogP | 4.99 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|