C23H35NO5S — CID 91468100
7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-(3-methylphenyl)sulfanylbutyl]-3-nitrosocyclopentyl]heptanoic acid (PubChem CID 91468100) has the molecular formula C23H35NO5S and a molecular weight of 437.60 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-(3-methylphenyl)sulfanylbutyl]-3-nitrosocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-(3-methylphenyl)sulfanylbutyl]-3-nitrosocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 91468100 |
| Molecular Formula | C23H35NO5S |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-(3-methylphenyl)sulfanylbutyl]-3-nitrosocyclopentyl]heptanoic acid |
| SMILES | Cc1cccc(SC[C@H](O)CC[C@H]2C(N=O)C[C@H](O)[C@@H]2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H35NO5S/c1-16-7-6-8-18(13-16)30-15-17(25)11-12-19-20(22(26)14-21(19)24-29)9-4-2-3-5-10-23(27)28/h6-8,13,17,19-22,25-26H,2-5,9-12,14-15H2,1H3,(H,27,28)/t17-,19-,20-,21?,22+/m1/s1 |
| InChIKey | SXIIKNQOEQLQNH-SQCFFINPSA-N |
| XLogP | 4.79 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|