C27H40O6S — CID 175161292
7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]-2-(hydroxymethyl)-2-propylheptanoic acid (PubChem CID 175161292) has the molecular formula C27H40O6S and a molecular weight of 492.68 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]-2-(hydroxymethyl)-2-propylheptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]-2-(hydroxymethyl)-2-propylheptanoic acid |
|---|---|
| PubChem CID | 175161292 |
| Molecular Formula | C27H40O6S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]-2-(hydroxymethyl)-2-propylheptanoic acid |
| SMILES | CCCC(CO)(CCCCC[C@@H]1[C@@H](CCC(O)c2cc3ccccc3s2)[C@H](O)C[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C27H40O6S/c1-2-13-27(17-28,26(32)33)14-7-3-4-9-19-20(23(31)16-22(19)30)11-12-21(29)25-15-18-8-5-6-10-24(18)34-25/h5-6,8,10,15,19-23,28-31H,2-4,7,9,11-14,16-17H2,1H3,(H,32,33)/t19-,20-,21?,22+,23-,27?/m1/s1 |
| InChIKey | PPSIZYLGFSGSQX-CIVXRAHPSA-N |
| XLogP | 4.89 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|