C28H35ClO5S — CID 10369368
methyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 10369368) has the molecular formula C28H35ClO5S and a molecular weight of 519.10 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10369368 |
| Molecular Formula | C28H35ClO5S |
| Molecular Weight | 519.10 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | methyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/C(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C28H35ClO5S/c1-28(2)26(32)19(10-6-4-5-7-13-24(31)34-3)20(27(28)33)16-14-18(30)15-17-23-25(29)21-11-8-9-12-22(21)35-23/h4,6,8-9,11-12,14,16,18-20,27,30,33H,5,7,10,13,15,17H2,1-3H3/b6-4-,16-14+/t18?,19-,20-,27+/m1/s1 |
| InChIKey | KXQYFWREBNFZKI-HFZQZZKLSA-N |
| XLogP | 5.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.10 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|