C32H52O3SSi — CID 90440756
8-[(1R,2S,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)butyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentyl]octanoic acid (PubChem CID 90440756) has the molecular formula C32H52O3SSi and a molecular weight of 544.92 g/mol. Its IUPAC name is 8-[(1R,2S,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)butyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentyl]octanoic acid.
| Compound Name | 8-[(1R,2S,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)butyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentyl]octanoic acid |
|---|---|
| PubChem CID | 90440756 |
| Molecular Formula | C32H52O3SSi |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 8-[(1R,2S,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)butyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentyl]octanoic acid |
| SMILES | C[C@H](CC[C@@H]1[C@@H](CCCCCCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C32H52O3SSi/c1-23(30-22-25-15-13-14-17-29(25)36-30)19-20-26-24(2)21-28(35-37(6,7)32(3,4)5)27(26)16-11-9-8-10-12-18-31(33)34/h13-15,17,22-24,26-28H,8-12,16,18-21H2,1-7H3,(H,33,34)/t23-,24-,26+,27-,28+/m1/s1 |
| InChIKey | UANYHDWWCTYMFJ-SUUNGRLWSA-N |
| XLogP | 10.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|