C23H28F2O4S — CID 77165229
7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-oxocyclopentyl]heptanoic acid (PubChem CID 77165229) has the molecular formula C23H28F2O4S and a molecular weight of 438.54 g/mol. Its IUPAC name is 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 77165229 |
| Molecular Formula | C23H28F2O4S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(CCC(O)c2cc3ccccc3s2)C(=O)CC1(F)F |
| InChI | InChI=1S/C23H28F2O4S/c24-23(25)14-19(27)16(17(23)8-3-1-2-4-10-22(28)29)11-12-18(26)21-13-15-7-5-6-9-20(15)30-21/h5-7,9,13,16-18,26H,1-4,8,10-12,14H2,(H,28,29) |
| InChIKey | UJYQZVASIOFEOF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|