C11H10O3S — CID 102424617
(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropanoic acid (PubChem CID 102424617) has the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. Its IUPAC name is (3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropanoic acid.
| Compound Name | (3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 102424617 |
| Molecular Formula | C11H10O3S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C[C@@H](O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C11H10O3S/c12-8(6-11(13)14)10-5-7-3-1-2-4-9(7)15-10/h1-5,8,12H,6H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | KHDNHZGTVVIDCC-MRVPVSSYSA-N |
| XLogP | 2.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |