C12H16N2O3S2 — CID 71967723
2-[2-(dimethylsulfamoylamino)-1-hydroxyethyl]-1-benzothiophene (PubChem CID 71967723) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoylamino)-1-hydroxyethyl]-1-benzothiophene.
| Compound Name | 2-[2-(dimethylsulfamoylamino)-1-hydroxyethyl]-1-benzothiophene |
|---|---|
| PubChem CID | 71967723 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[2-(dimethylsulfamoylamino)-1-hydroxyethyl]-1-benzothiophene |
| SMILES | CN(C)S(=O)(=O)NCC(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-14(2)19(16,17)13-8-10(15)12-7-9-5-3-4-6-11(9)18-12/h3-7,10,13,15H,8H2,1-2H3 |
| InChIKey | YSIPNJKECOBCIP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |