C16H15NO2S2 — CID 97073876
N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-methylthiophene-3-carboxamide (PubChem CID 97073876) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-methylthiophene-3-carboxamide.
| Compound Name | N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 97073876 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)NC[C@H](O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H15NO2S2/c1-10-8-20-9-12(10)16(19)17-7-13(18)15-6-11-4-2-3-5-14(11)21-15/h2-6,8-9,13,18H,7H2,1H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | GRDNDPWVDWZUOA-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |