C21H20N2O3S — CID 97017538
N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-(cyclopropanecarbonylamino)benzamide (PubChem CID 97017538) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-(cyclopropanecarbonylamino)benzamide.
| Compound Name | N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-(cyclopropanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 97017538 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxyethyl]-4-(cyclopropanecarbonylamino)benzamide |
| SMILES | O=C(NC[C@@H](O)c1cc2ccccc2s1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c24-17(19-11-15-3-1-2-4-18(15)27-19)12-22-20(25)13-7-9-16(10-8-13)23-21(26)14-5-6-14/h1-4,7-11,14,17,24H,5-6,12H2,(H,22,25)(H,23,26)/t17-/m1/s1 |
| InChIKey | GBWVHRYWJHUCBS-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |