C37H72O5Si3 — CID 102019432
4-[(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]cyclopentyl]butan-1-ol (PubChem CID 102019432) has the molecular formula C37H72O5Si3 and a molecular weight of 681.24 g/mol. Its IUPAC name is 4-[(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]cyclopentyl]butan-1-ol.
| Compound Name | 4-[(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]cyclopentyl]butan-1-ol |
|---|---|
| PubChem CID | 102019432 |
| Molecular Formula | C37H72O5Si3 |
| Molecular Weight | 681.24 g/mol |
| Exact Mass | 680.47 |
| IUPAC Name | 4-[(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]cyclopentyl]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC[C@@H]1[C@@H](CCCCO)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)COc1ccccc1 |
| InChI | InChI=1S/C37H72O5Si3/c1-35(2,3)43(10,11)40-30(28-39-29-21-17-16-18-22-29)24-25-32-31(23-19-20-26-38)33(41-44(12,13)36(4,5)6)27-34(32)42-45(14,15)37(7,8)9/h16-18,21-22,30-34,38H,19-20,23-28H2,1-15H3/t30-,31-,32-,33+,34-/m1/s1 |
| InChIKey | YBCXCDCSLMGMAI-VIYJWPFNSA-N |
| XLogP | 10.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.24 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|