C28H56O4Si2 — CID 59075699
3-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(7-oxooctyl)cyclopentyl]propanal (PubChem CID 59075699) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is 3-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(7-oxooctyl)cyclopentyl]propanal.
| Compound Name | 3-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(7-oxooctyl)cyclopentyl]propanal |
|---|---|
| PubChem CID | 59075699 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | 3-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(7-oxooctyl)cyclopentyl]propanal |
| SMILES | CC(=O)CCCCCC[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCC=O |
| InChI | InChI=1S/C28H56O4Si2/c1-22(30)17-14-12-13-15-18-23-24(19-16-20-29)26(32-34(10,11)28(5,6)7)21-25(23)31-33(8,9)27(2,3)4/h20,23-26H,12-19,21H2,1-11H3/t23-,24-,25+,26?/m1/s1 |
| InChIKey | ZRXUQLGULWPMRE-DYXQDRAXSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|