C19H34O5Si — CID 18594733
7-[(1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-formyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 18594733) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is 7-[(1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-formyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-formyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18594733 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 7-[(1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-formyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)[C@@H](CCCCCCC(=O)O)[C@@H]1C=O |
| InChI | InChI=1S/C19H34O5Si/c1-19(2,3)25(4,5)24-17-12-16(21)14(15(17)13-20)10-8-6-7-9-11-18(22)23/h13-15,17H,6-12H2,1-5H3,(H,22,23)/t14-,15-,17-/m0/s1 |
| InChIKey | IMMKEUAAHWCPMZ-ZOBUZTSGSA-N |
| XLogP | 4.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|