C23H38O7 — CID 22806362
methyl 7-[(1S,2S,3S,5R)-5-acetyloxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]heptanoate (PubChem CID 22806362) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is methyl 7-[(1S,2S,3S,5R)-5-acetyloxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2S,3S,5R)-5-acetyloxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22806362 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | methyl 7-[(1S,2S,3S,5R)-5-acetyloxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@H](CCC=O)[C@@H](OC2CCCCO2)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H38O7/c1-17(25)29-20-16-21(30-23-13-7-8-15-28-23)19(11-9-14-24)18(20)10-5-3-4-6-12-22(26)27-2/h14,18-21,23H,3-13,15-16H2,1-2H3/t18-,19-,20+,21-,23?/m0/s1 |
| InChIKey | ZTXMSXIQYMXLOG-XURRJDJLSA-N |
| XLogP | 3.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|