C26H48O7Si — CID 123651935
7-[(1R,2S,3R,5S)-5-acetyloxy-2-[(1R)-1-dimethylsilyloxy-2,2-dimethylpropyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 123651935) has the molecular formula C26H48O7Si and a molecular weight of 500.75 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-5-acetyloxy-2-[(1R)-1-dimethylsilyloxy-2,2-dimethylpropyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R,5S)-5-acetyloxy-2-[(1R)-1-dimethylsilyloxy-2,2-dimethylpropyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 123651935 |
| Molecular Formula | C26H48O7Si |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-5-acetyloxy-2-[(1R)-1-dimethylsilyloxy-2,2-dimethylpropyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC2CCCCO2)[C@@H]([C@@H](O[SiH](C)C)C(C)(C)C)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H48O7Si/c1-18(27)31-20-17-21(32-23-15-11-12-16-30-23)24(25(26(2,3)4)33-34(5)6)19(20)13-9-7-8-10-14-22(28)29/h19-21,23-25,34H,7-17H2,1-6H3,(H,28,29)/t19-,20-,21+,23?,24-,25+/m0/s1 |
| InChIKey | RZYLPFSSSFDYLO-JJQGKJPASA-N |
| XLogP | 5.31 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|