C31H57NO7Si — CID 173270227
7-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-N-(methoxymethyl)hept-5-enamide (PubChem CID 173270227) has the molecular formula C31H57NO7Si and a molecular weight of 583.88 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-N-(methoxymethyl)hept-5-enamide.
| Compound Name | 7-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-N-(methoxymethyl)hept-5-enamide |
|---|---|
| PubChem CID | 173270227 |
| Molecular Formula | C31H57NO7Si |
| Molecular Weight | 583.88 g/mol |
| Exact Mass | 583.39 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-N-(methoxymethyl)hept-5-enamide |
| SMILES | COCNC(=O)CCCC=CC[C@@H]1[C@H](C(O[SiH](C)C)C(C)(C)C)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C31H57NO7Si/c1-31(2,3)30(39-40(5)6)29-23(15-9-7-8-10-16-26(33)32-22-34-4)24(37-27-17-11-13-19-35-27)21-25(29)38-28-18-12-14-20-36-28/h7,9,23-25,27-30,40H,8,10-22H2,1-6H3,(H,32,33)/t23-,24-,25+,27?,28?,29-,30?/m0/s1 |
| InChIKey | QYQJVYUYJPQPAH-KDERIALVSA-N |
| XLogP | 5.70 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|