C30H48F2O7 — CID 67703209
(Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 67703209) has the molecular formula C30H48F2O7 and a molecular weight of 558.70 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67703209 |
| Molecular Formula | C30H48F2O7 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)C(=O)CCC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C30H48F2O7/c1-2-18-30(31,32)26(33)14-11-13-23-22(12-5-3-4-6-15-27(34)35)24(38-28-16-7-9-19-36-28)21-25(23)39-29-17-8-10-20-37-29/h3,5,22-25,28-29H,2,4,6-21H2,1H3,(H,34,35)/b5-3-/t22-,23-,24+,25-,28?,29?/m1/s1 |
| InChIKey | YRVKQMTTXMPEDP-SMZLRKAKSA-N |
| XLogP | 6.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|