C18H27ClO5 — CID 87567584
(E)-7-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 87567584) has the molecular formula C18H27ClO5 and a molecular weight of 358.86 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 87567584 |
| Molecular Formula | C18H27ClO5 |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (E)-7-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C[C@@H]1[C@@H](C/C=C/CCCC(=O)O)[C@H](Cl)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C18H27ClO5/c19-15-11-16(24-18-9-5-6-10-23-18)14(12-20)13(15)7-3-1-2-4-8-17(21)22/h1,3,12-16,18H,2,4-11H2,(H,21,22)/b3-1+/t13-,14-,15-,16-,18?/m1/s1 |
| InChIKey | JVVMENXVFURGQY-YMZBBTKISA-N |
| XLogP | 3.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|