C26H48O6Si — CID 59958215
(Z)-9-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoic acid (PubChem CID 59958215) has the molecular formula C26H48O6Si and a molecular weight of 484.75 g/mol. Its IUPAC name is (Z)-9-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoic acid.
| Compound Name | (Z)-9-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoic acid |
|---|---|
| PubChem CID | 59958215 |
| Molecular Formula | C26H48O6Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (Z)-9-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C(OC2CCCCO2)CC(O)C1C/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C26H48O6Si/c1-26(2,3)33(4,5)31-19-21-20(14-10-8-6-7-9-11-15-24(28)29)22(27)18-23(21)32-25-16-12-13-17-30-25/h8,10,20-23,25,27H,6-7,9,11-19H2,1-5H3,(H,28,29)/b10-8-/t20?,21-,22?,23?,25?/m1/s1 |
| InChIKey | QCJLWOFCDOKVPG-XVKHLTFASA-N |
| XLogP | 5.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|