C30H54O6Si — CID 70157877
(Z)-8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]oct-6-en-2-one (PubChem CID 70157877) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is (Z)-8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]oct-6-en-2-one.
| Compound Name | (Z)-8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 70157877 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (Z)-8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]oct-6-en-2-one |
| SMILES | CC(=O)CCC/C=C\C[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C30H54O6Si/c1-23(31)15-9-7-8-10-16-24-25(22-34-37(5,6)30(2,3)4)27(36-29-18-12-14-20-33-29)21-26(24)35-28-17-11-13-19-32-28/h8,10,24-29H,7,9,11-22H2,1-6H3/b10-8-/t24-,25-,26+,27-,28?,29?/m1/s1 |
| InChIKey | QSNYNKLFQBOCOB-VEWIPCRXSA-N |
| XLogP | 7.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|