C42H68O9Si — CID 154128788
[8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-yl] benzoate (PubChem CID 154128788) has the molecular formula C42H68O9Si and a molecular weight of 745.08 g/mol. Its IUPAC name is [8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-yl] benzoate.
| Compound Name | [8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-yl] benzoate |
|---|---|
| PubChem CID | 154128788 |
| Molecular Formula | C42H68O9Si |
| Molecular Weight | 745.08 g/mol |
| Exact Mass | 744.46 |
| IUPAC Name | [8-[(1R,2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](CC=CCCCC(COC2CCCCO2)OC(=O)c2ccccc2)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C42H68O9Si/c1-42(2,3)52(4,5)48-31-35-34(36(50-39-24-14-17-27-45-39)29-37(35)51-40-25-15-18-28-46-40)22-12-7-6-11-21-33(30-47-38-23-13-16-26-44-38)49-41(43)32-19-9-8-10-20-32/h7-10,12,19-20,33-40H,6,11,13-18,21-31H2,1-5H3/t33?,34-,35-,36+,37-,38?,39?,40?/m1/s1 |
| InChIKey | JWXYAJDZORSMQZ-WGCWZBOVSA-N |
| XLogP | 9.35 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.08 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|