C25H37NO5 — CID 54567887
7-[(1S,2S,3S,5R)-2-(methylamino)-3-(oxan-2-yloxy)-5-phenylmethoxycyclopentyl]hept-5-enoic acid (PubChem CID 54567887) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is 7-[(1S,2S,3S,5R)-2-(methylamino)-3-(oxan-2-yloxy)-5-phenylmethoxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3S,5R)-2-(methylamino)-3-(oxan-2-yloxy)-5-phenylmethoxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54567887 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 7-[(1S,2S,3S,5R)-2-(methylamino)-3-(oxan-2-yloxy)-5-phenylmethoxycyclopentyl]hept-5-enoic acid |
| SMILES | CN[C@H]1[C@H](CC=CCCCC(=O)O)[C@H](OCc2ccccc2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H37NO5/c1-26-25-20(13-7-2-3-8-14-23(27)28)21(30-18-19-11-5-4-6-12-19)17-22(25)31-24-15-9-10-16-29-24/h2,4-7,11-12,20-22,24-26H,3,8-10,13-18H2,1H3,(H,27,28)/t20-,21-,22+,24?,25+/m1/s1 |
| InChIKey | ZVCZXCLVMOZYSE-VDWCEDTGSA-N |
| XLogP | 4.29 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|