C30H39NO5 — CID 12941384
(Z)-7-[(1R,2R,3R,5S)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid (PubChem CID 12941384) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 12941384 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](N2CCOCC2)[C@H](O)C[C@@H]1OCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H39NO5/c32-27-21-28(36-22-25-14-12-24(13-15-25)20-23-8-4-3-5-9-23)26(10-6-1-2-7-11-29(33)34)30(27)31-16-18-35-19-17-31/h1,3-6,8-9,12-15,26-28,30,32H,2,7,10-11,16-22H2,(H,33,34)/b6-1-/t26-,27+,28-,30+/m0/s1 |
| InChIKey | ZWPKQVPFAJLTIB-DKTSBBFVSA-N |
| XLogP | 4.45 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|