C25H38N2O7S — CID 57072343
7-[(1R,2R,3R,5S)-5-[[4-(dimethylsulfamoyl)phenyl]methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid (PubChem CID 57072343) has the molecular formula C25H38N2O7S and a molecular weight of 510.65 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-[[4-(dimethylsulfamoyl)phenyl]methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-[[4-(dimethylsulfamoyl)phenyl]methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57072343 |
| Molecular Formula | C25H38N2O7S |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-[[4-(dimethylsulfamoyl)phenyl]methoxy]-3-hydroxy-2-morpholin-4-ylcyclopentyl]hept-5-enoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(CO[C@H]2C[C@@H](O)[C@H](N3CCOCC3)[C@H]2CC=CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H38N2O7S/c1-26(2)35(31,32)20-11-9-19(10-12-20)18-34-23-17-22(28)25(27-13-15-33-16-14-27)21(23)7-5-3-4-6-8-24(29)30/h3,5,9-12,21-23,25,28H,4,6-8,13-18H2,1-2H3,(H,29,30)/t21-,22+,23-,25+/m0/s1 |
| InChIKey | USMGRRFCCSZKBE-ONTNHIFESA-N |
| XLogP | 2.10 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|