C32H37NO6S — CID 57037315
7-[(1R,2R,3R,5S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-5-enoic acid (PubChem CID 57037315) has the molecular formula C32H37NO6S and a molecular weight of 563.72 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57037315 |
| Molecular Formula | C32H37NO6S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-5-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2[C@@H](CC=CCCCC(=O)O)[C@@H](OCc3ccc(-c4ccccc4)cc3)C[C@H]2O)cc1 |
| InChI | InChI=1S/C32H37NO6S/c1-23-13-19-27(20-14-23)40(37,38)33-32-28(11-7-2-3-8-12-31(35)36)30(21-29(32)34)39-22-24-15-17-26(18-16-24)25-9-5-4-6-10-25/h2,4-7,9-10,13-20,28-30,32-34H,3,8,11-12,21-22H2,1H3,(H,35,36)/t28-,29+,30-,32+/m0/s1 |
| InChIKey | AWCIBFXJCKLDSY-ZREVQEDVSA-N |
| XLogP | 5.48 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|