C40H43NO7S — CID 57306408
[(1R,2R,3R,4S)-3-(7-methoxy-7-oxohept-2-enyl)-2-[(4-methylphenyl)sulfonylamino]-4-[(4-phenylphenyl)methoxy]cyclopentyl] benzoate (PubChem CID 57306408) has the molecular formula C40H43NO7S and a molecular weight of 681.85 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-(7-methoxy-7-oxohept-2-enyl)-2-[(4-methylphenyl)sulfonylamino]-4-[(4-phenylphenyl)methoxy]cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3R,4S)-3-(7-methoxy-7-oxohept-2-enyl)-2-[(4-methylphenyl)sulfonylamino]-4-[(4-phenylphenyl)methoxy]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 57306408 |
| Molecular Formula | C40H43NO7S |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | [(1R,2R,3R,4S)-3-(7-methoxy-7-oxohept-2-enyl)-2-[(4-methylphenyl)sulfonylamino]-4-[(4-phenylphenyl)methoxy]cyclopentyl] benzoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](NS(=O)(=O)c2ccc(C)cc2)[C@H](OC(=O)c2ccccc2)C[C@@H]1OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H43NO7S/c1-29-19-25-34(26-20-29)49(44,45)41-39-35(17-11-3-4-12-18-38(42)46-2)36(27-37(39)48-40(43)33-15-9-6-10-16-33)47-28-30-21-23-32(24-22-30)31-13-7-5-8-14-31/h3,5-11,13-16,19-26,35-37,39,41H,4,12,17-18,27-28H2,1-2H3/t35-,36-,37+,39+/m0/s1 |
| InChIKey | YBXHFLLKSAAZNV-CHLKKWGUSA-N |
| XLogP | 7.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|