C20H27NO4S — CID 14507247
methyl (Z)-7-[(1R,2S,3S,5R)-3-(benzenesulfonamido)-2-bicyclo[3.1.0]hexanyl]hept-5-enoate (PubChem CID 14507247) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3S,5R)-3-(benzenesulfonamido)-2-bicyclo[3.1.0]hexanyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3S,5R)-3-(benzenesulfonamido)-2-bicyclo[3.1.0]hexanyl]hept-5-enoate |
|---|---|
| PubChem CID | 14507247 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3S,5R)-3-(benzenesulfonamido)-2-bicyclo[3.1.0]hexanyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@@H]2C[C@@H]2C[C@@H]1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO4S/c1-25-20(22)12-8-3-2-7-11-17-18-13-15(18)14-19(17)21-26(23,24)16-9-5-4-6-10-16/h2,4-7,9-10,15,17-19,21H,3,8,11-14H2,1H3/b7-2-/t15-,17+,18-,19+/m1/s1 |
| InChIKey | HXGNKEKSHUSGEJ-ZHAWDCQOSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|