C18H23NO4S2 — CID 54072046
7-[(1S,2R,3S,5R)-3-(benzenesulfonamido)-6-thiabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid (PubChem CID 54072046) has the molecular formula C18H23NO4S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 7-[(1S,2R,3S,5R)-3-(benzenesulfonamido)-6-thiabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R,3S,5R)-3-(benzenesulfonamido)-6-thiabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54072046 |
| Molecular Formula | C18H23NO4S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 7-[(1S,2R,3S,5R)-3-(benzenesulfonamido)-6-thiabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@@H]2S[C@@H]2C[C@@H]1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO4S2/c20-17(21)11-7-2-1-6-10-14-15(12-16-18(14)24-16)19-25(22,23)13-8-4-3-5-9-13/h1,3-6,8-9,14-16,18-19H,2,7,10-12H2,(H,20,21)/t14-,15+,16-,18+/m1/s1 |
| InChIKey | MHCZHBYADWKMCQ-HPFXQQBRSA-N |
| XLogP | 3.04 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|