C15H21NO4S — CID 15052909
(Z)-9-(benzenesulfonamido)non-5-enoic acid (PubChem CID 15052909) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (Z)-9-(benzenesulfonamido)non-5-enoic acid.
| Compound Name | (Z)-9-(benzenesulfonamido)non-5-enoic acid |
|---|---|
| PubChem CID | 15052909 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (Z)-9-(benzenesulfonamido)non-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO4S/c17-15(18)12-8-3-1-2-4-9-13-16-21(19,20)14-10-6-5-7-11-14/h1-2,5-7,10-11,16H,3-4,8-9,12-13H2,(H,17,18)/b2-1- |
| InChIKey | OUMPGEOOYZYXNI-UPHRSURJSA-N |
| XLogP | 2.56 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|