C23H39N3O3S — CID 77140945
1-[11-(benzenesulfonamido)undec-5-enyl]-3-pentylurea (PubChem CID 77140945) has the molecular formula C23H39N3O3S and a molecular weight of 437.65 g/mol. Its IUPAC name is 1-[11-(benzenesulfonamido)undec-5-enyl]-3-pentylurea.
| Compound Name | 1-[11-(benzenesulfonamido)undec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 77140945 |
| Molecular Formula | C23H39N3O3S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-[11-(benzenesulfonamido)undec-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCCC=CCCCCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H39N3O3S/c1-2-3-14-19-24-23(27)25-20-15-9-7-5-4-6-8-10-16-21-26-30(28,29)22-17-12-11-13-18-22/h4-5,11-13,17-18,26H,2-3,6-10,14-16,19-21H2,1H3,(H2,24,25,27) |
| InChIKey | HFXDODUDEXSROA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|