C19H27NO6S — CID 10408509
(E)-7-[(4R,5R)-5-(benzenesulfonamidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-enoic acid (PubChem CID 10408509) has the molecular formula C19H27NO6S and a molecular weight of 397.49 g/mol. Its IUPAC name is (E)-7-[(4R,5R)-5-(benzenesulfonamidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[(4R,5R)-5-(benzenesulfonamidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10408509 |
| Molecular Formula | C19H27NO6S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (E)-7-[(4R,5R)-5-(benzenesulfonamidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-enoic acid |
| SMILES | CC1(C)O[C@H](C/C=C/CCCC(=O)O)[C@@H](CNS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H27NO6S/c1-19(2)25-16(12-8-3-4-9-13-18(21)22)17(26-19)14-20-27(23,24)15-10-6-5-7-11-15/h3,5-8,10-11,16-17,20H,4,9,12-14H2,1-2H3,(H,21,22)/b8-3+/t16-,17-/m1/s1 |
| InChIKey | YYAREIKDHFQMEE-RYRNWLTQSA-N |
| XLogP | 2.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|