C19H26O4S — CID 54366447
7-[(5R,6R)-6-(2-hydroxyphenyl)-2,2-dimethyl-1,3-oxathian-5-yl]hept-5-enoic acid (PubChem CID 54366447) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is 7-[(5R,6R)-6-(2-hydroxyphenyl)-2,2-dimethyl-1,3-oxathian-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(5R,6R)-6-(2-hydroxyphenyl)-2,2-dimethyl-1,3-oxathian-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54366447 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 7-[(5R,6R)-6-(2-hydroxyphenyl)-2,2-dimethyl-1,3-oxathian-5-yl]hept-5-enoic acid |
| SMILES | CC1(C)O[C@@H](c2ccccc2O)[C@@H](CC=CCCCC(=O)O)CS1 |
| InChI | InChI=1S/C19H26O4S/c1-19(2)23-18(15-10-7-8-11-16(15)20)14(13-24-19)9-5-3-4-6-12-17(21)22/h3,5,7-8,10-11,14,18,20H,4,6,9,12-13H2,1-2H3,(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | UQCWZXSXFVWKDR-KBXCAEBGSA-N |
| XLogP | 4.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|