C18H24O5 — CID 14188289
(E)-6-[4-(2-hydroxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 14188289) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (E)-6-[4-(2-hydroxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (E)-6-[4-(2-hydroxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 14188289 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (E)-6-[4-(2-hydroxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | CC1(C)OCC(C/C=C/CCC(=O)O)C(c2ccccc2O)O1 |
| InChI | InChI=1S/C18H24O5/c1-18(2)22-12-13(8-4-3-5-11-16(20)21)17(23-18)14-9-6-7-10-15(14)19/h3-4,6-7,9-10,13,17,19H,5,8,11-12H2,1-2H3,(H,20,21)/b4-3+ |
| InChIKey | YBYNXTNZZGRVOP-ONEGZZNKSA-N |
| XLogP | 3.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|