C26H26O5 — CID 59396914
(Z)-6-[(4S,5R)-4-(2-hydroxyphenyl)-2-naphthalen-1-yl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 59396914) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (Z)-6-[(4S,5R)-4-(2-hydroxyphenyl)-2-naphthalen-1-yl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(4S,5R)-4-(2-hydroxyphenyl)-2-naphthalen-1-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 59396914 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (Z)-6-[(4S,5R)-4-(2-hydroxyphenyl)-2-naphthalen-1-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1COC(c2cccc3ccccc23)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C26H26O5/c27-23-15-7-6-13-22(23)25-19(10-2-1-3-16-24(28)29)17-30-26(31-25)21-14-8-11-18-9-4-5-12-20(18)21/h1-2,4-9,11-15,19,25-27H,3,10,16-17H2,(H,28,29)/b2-1-/t19-,25+,26?/m1/s1 |
| InChIKey | WINMUTQNUDISOJ-LJIOKLCUSA-N |
| XLogP | 5.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|