C20H28O5 — CID 58360164
(Z)-7-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hept-4-enoic acid (PubChem CID 58360164) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (Z)-7-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hept-4-enoic acid |
|---|---|
| PubChem CID | 58360164 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (Z)-7-[(4S,5R)-4-(2-methoxyphenyl)-2,2-dimethyl-1,3-dioxan-5-yl]hept-4-enoic acid |
| SMILES | COc1ccccc1[C@H]1OC(C)(C)OC[C@H]1CC/C=C\CCC(=O)O |
| InChI | InChI=1S/C20H28O5/c1-20(2)24-14-15(10-6-4-5-7-13-18(21)22)19(25-20)16-11-8-9-12-17(16)23-3/h4-5,8-9,11-12,15,19H,6-7,10,13-14H2,1-3H3,(H,21,22)/b5-4-/t15-,19+/m1/s1 |
| InChIKey | MMNQGBCEDLGANV-FDVMBTMHSA-N |
| XLogP | 4.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|